3-(ethylamino-methyl)-rifamycin
Modify Date: 2025-08-23 12:55:45
3-(ethylamino-methyl)-rifamycin structure
|
Common Name | 3-(ethylamino-methyl)-rifamycin | ||
|---|---|---|---|---|
| CAS Number | 38129-09-8 | Molecular Weight | 754.86300 | |
| Density | 1.32g/cm3 | Boiling Point | 879.6ºC at 760 mmHg | |
| Molecular Formula | C40H54N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 485.8ºC | |
| Name | 3-(ethylamino-methyl)-rifamycin |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 879.6ºC at 760 mmHg |
| Molecular Formula | C40H54N2O12 |
| Molecular Weight | 754.86300 |
| Flash Point | 485.8ºC |
| Exact Mass | 754.36800 |
| PSA | 213.34000 |
| LogP | 5.39250 |
| Index of Refraction | 1.623 |
| InChIKey | SIBVBKHRYDYBGO-SFCYWRCFSA-N |
| SMILES | CCNCc1c2c(O)c3c(O)c(C)c4c(c3c1O)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
3-(ethylamino-m... CAS#:38129-09-8 |
| Literature: McCarthy; Moore; Wysong; Aldrich Journal of Medicinal Chemistry, 1977 , vol. 20, # 10 p. 1272 - 1276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |