3-(cyclopentylhydrazono-methyl)-rifamycin
3-(cyclopentylhydrazono-methyl)-rifamycin structure
|
Common Name | 3-(cyclopentylhydrazono-methyl)-rifamycin | ||
|---|---|---|---|---|
| CAS Number | 38136-09-3 | Molecular Weight | 807.92600 | |
| Density | 1.33g/cm3 | Boiling Point | 911ºC at 760 mmHg | |
| Molecular Formula | C43H57N3O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 504.7ºC | |
Summary: 3-(cyclopentylhydrazono-methyl)-rifamycin, Chinese name is 3-(环戊基氢亚胺甲基)-链霉菌素, CAS number is 38136-09-3, molecular formula is C43H57N3O12, and molecular weight is 807.92600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(cyclopentylhydrazono-methyl)-rifamycin |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 911ºC at 760 mmHg |
| Molecular Formula | C43H57N3O12 |
| Molecular Weight | 807.92600 |
| Flash Point | 504.7ºC |
| Exact Mass | 807.39400 |
| PSA | 225.70000 |
| LogP | 6.14910 |
| Index of Refraction | 1.62 |
| InChIKey | BWDHWLPSYUFLAA-JFDZYJIASA-N |
| SMILES | COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(c(C=NNC5CCCC5)c(O)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-(cyclopentylh... CAS#:38136-09-3 |
| Literature: Cricchio; Carniti; Cietto; Tamborini; Arioli Farmaco, Edizione Scientifica, 1975 , vol. 30, # 9 p. 704 - 720 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| rifaldehyde cyclopentylhydrazone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3-(cyclopentylhydrazono-methyl)-rifamycin? |
| A: Polar surface area (PSA) of 3-(cyclopentylhydrazono-methyl)-rifamycin is 225.70000. |
| Q: What are the upstream materials of 3-(cyclopentylhydrazono-methyl)-rifamycin? |
| A: Related upstream materials(CAS) of 3-(cyclopentylhydrazono-methyl)-rifamycin: 13292-22-3;30923-92-3. |
| Q: What is the Chinese name of 38136-09-3? |
| A: Chinese name of 38136-09-3 is 38136-09-3. |
| Q: What English synonyms does 3-(cyclopentylhydrazono-methyl)-rifamycin have? |
| A: English synonyms of 3-(cyclopentylhydrazono-methyl)-rifamycin: rifaldehyde cyclopentylhydrazone. |
| Q: What is the CAS number of 3-(cyclopentylhydrazono-methyl)-rifamycin? |
| A: CAS number of 3-(cyclopentylhydrazono-methyl)-rifamycin is 38136-09-3. |
| Q: What is the LogP of 3-(cyclopentylhydrazono-methyl)-rifamycin? |
| A: LogP of 3-(cyclopentylhydrazono-methyl)-rifamycin is 6.14910. |
| Q: What is the English name of 3-(cyclopentylhydrazono-methyl)-rifamycin? |
| A: The English name of 3-(cyclopentylhydrazono-methyl)-rifamycin is 3-(cyclopentylhydrazono-methyl)-rifamycin. |
| Q: What is the molecular weight of 3-(cyclopentylhydrazono-methyl)-rifamycin? |
| A: Molecular weight of 3-(cyclopentylhydrazono-methyl)-rifamycin is 807.92600. |
| Q: What is the molecular formula of 3-(cyclopentylhydrazono-methyl)-rifamycin? |
| A: Molecular formula of 3-(cyclopentylhydrazono-methyl)-rifamycin is C43H57N3O12. |
| Q: What is the InChIKey of 3-(cyclopentylhydrazono-methyl)-rifamycin? |
| A: InChIKey of 3-(cyclopentylhydrazono-methyl)-rifamycin is BWDHWLPSYUFLAA-JFDZYJIASA-N. |