H-Trp-Pro-OH structure
|
Common Name | H-Trp-Pro-OH | ||
|---|---|---|---|---|
| CAS Number | 38136-75-3 | Molecular Weight | 301.34000 | |
| Density | 1.389g/cm3 | Boiling Point | 626.426ºC at 760 mmHg | |
| Molecular Formula | C16H19N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.651ºC | |
| Name | h-trp-pro-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 626.426ºC at 760 mmHg |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.34000 |
| Flash Point | 332.651ºC |
| Exact Mass | 301.14300 |
| PSA | 99.42000 |
| LogP | 1.75150 |
| InChIKey | DXYQIGZZWYBXSD-JSGCOSHPSA-N |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)N1CCCC1C(=O)O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Percent inhibition of Dipeptidyl peptidase IV (DPP IV) at a concentration of 10 uM
Source: ChEMBL
Target: Dipeptidyl peptidase 4
External Id: CHEMBL857575
|
| REF DUPL: H-Trp-Pro-OH |
| L-TRYPTOPHYL-L-PROLINE |