(2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid
Modify Date: 2026-07-30 21:08:28
![(2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid Structure](https://www.chemsrc.com/extcaspic/373/38136-82-2.png)
(2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid structure
|
Common Name | (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 38136-82-2 | Molecular Weight | 281.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15N5O4 |
|---|---|
| Molecular Weight | 281.27 |
| InChIKey | QLVNICOSAXDMMV-HTRCEHHLSA-N |
| SMILES | CN(C)c1ncnc2c1ncn2CC(O)C(O)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid? |
| A: CAS number of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid is 38136-82-2. |
| Q: What is the molecular formula of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid? |
| A: Molecular formula of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid is C11H15N5O4. |
| Q: What is the English name of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid? |
| A: The English name of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid is (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid. |
| Q: What is the InChIKey of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid? |
| A: InChIKey of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid is QLVNICOSAXDMMV-HTRCEHHLSA-N. |
| Q: What is the Chinese name of 38136-82-2? |
| A: Chinese name of 38136-82-2 is 38136-82-2. |
| Q: What is the molecular weight of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid? |
| A: Molecular weight of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid is 281.27. |
| Q: What is the SMILES notation of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid? |
| A: SMILES notation of (2R,3R)-4-[6-(dimethylamino)purin-9-yl]-2,3-dihydroxybutanoic acid is CN(C)c1ncnc2c1ncn2CC(O)C(O)C(=O)O. |