Unii-rtj0M35T4U
Modify Date: 2025-09-10 13:33:46
Unii-rtj0M35T4U structure
|
Common Name | Unii-rtj0M35T4U | ||
|---|---|---|---|---|
| CAS Number | 38136-92-4 | Molecular Weight | 365.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Unii-rtj0M35T4U |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H23N3O3 |
|---|---|
| Molecular Weight | 365.4 |
| InChIKey | MWOFPQAPILIIPR-RKTMXUFFSA-N |
| SMILES | CC1(C)C2CC34CCCN3C(=O)C2(CC12Nc1ccccc1C2=O)NC4=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Unii-rtj0M35T4U? |
| A: InChIKey of Unii-rtj0M35T4U is MWOFPQAPILIIPR-RKTMXUFFSA-N. |
| Q: What is the molecular formula of Unii-rtj0M35T4U? |
| A: Molecular formula of Unii-rtj0M35T4U is C21H23N3O3. |
| Q: What is the molecular weight of Unii-rtj0M35T4U? |
| A: Molecular weight of Unii-rtj0M35T4U is 365.4. |
| Q: What is the SMILES notation of Unii-rtj0M35T4U? |
| A: SMILES notation of Unii-rtj0M35T4U is CC1(C)C2CC34CCCN3C(=O)C2(CC12Nc1ccccc1C2=O)NC4=O. |
| Q: What is the CAS number of Unii-rtj0M35T4U? |
| A: CAS number of Unii-rtj0M35T4U is 38136-92-4. |
| Q: What is the English name of Unii-rtj0M35T4U? |
| A: The English name of Unii-rtj0M35T4U is Unii-rtj0M35T4U. |
| Q: What is the Chinese name of 38136-92-4? |
| A: Chinese name of 38136-92-4 is 38136-92-4. |