[5-chloro-2-[3-(hydroxymethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-phenylmethanone structure
|
Common Name | [5-chloro-2-[3-(hydroxymethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 38150-27-5 | Molecular Weight | 327.76500 | |
| Density | 1.34g/cm3 | Boiling Point | 593.7ºC at 760 mmHg | |
| Molecular Formula | C17H14ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.8ºC | |
| Name | [5-chloro-2-[3-(hydroxymethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 593.7ºC at 760 mmHg |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.76500 |
| Flash Point | 312.8ºC |
| Exact Mass | 327.07700 |
| PSA | 68.01000 |
| LogP | 2.95240 |
| Index of Refraction | 1.654 |
| InChIKey | UZEKJKOIIZBJFR-UHFFFAOYSA-N |
| SMILES | Cc1nnc(CO)n1-c1ccc(Cl)cc1C(=O)c1ccccc1 |
|
~71%
[5-chloro-2-[3-... CAS#:38150-27-5 |
| Literature: The Upjohn Company Patent: US3993660 A1, 1976 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 5-Chlor-2-<3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4yl>benzophenon |
| HB-Compound |
| EINECS 253-805-6 |
| 5-chloro-2-(3-hydroxymethyl-5-methyl-[1,2,4]triazol-4-yl)-benzophenone |
| 5-Chloro-2-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzophenone |
| 2-[3-(Hydroxymethyl)-5-methyl-4-triazolyl]-5-chlorobenzophenone |