Allofusicoccin
Modify Date: 2026-08-08 09:45:21
Allofusicoccin structure
|
Common Name | Allofusicoccin | ||
|---|---|---|---|---|
| CAS Number | 38179-95-2 | Molecular Weight | 680.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H56O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Allofusicoccin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C36H56O12 |
|---|---|
| Molecular Weight | 680.8 |
| InChIKey | VIDHLMDVVXUKKF-CHKMVKNFSA-N |
| SMILES | C=CC(C)(C)OCC1OC(OC2C3=C(C(C)COC(C)=O)CC(O)C3C(C)=C3C(COC)CCC3C(C)C2O)C(OC(C)=O)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Allofusicoccin? |
| A: Molecular weight of Allofusicoccin is 680.8. |
| Q: What is the InChIKey of Allofusicoccin? |
| A: InChIKey of Allofusicoccin is VIDHLMDVVXUKKF-CHKMVKNFSA-N. |
| Q: What is the molecular formula of Allofusicoccin? |
| A: Molecular formula of Allofusicoccin is C36H56O12. |
| Q: What is the Chinese name of 38179-95-2? |
| A: Chinese name of 38179-95-2 is 38179-95-2. |
| Q: What is the CAS number of Allofusicoccin? |
| A: CAS number of Allofusicoccin is 38179-95-2. |
| Q: What is the SMILES notation of Allofusicoccin? |
| A: SMILES notation of Allofusicoccin is C=CC(C)(C)OCC1OC(OC2C3=C(C(C)COC(C)=O)CC(O)C3C(C)=C3C(COC)CCC3C(C)C2O)C(OC(C)=O)C(O)C1O. |
| Q: What is the English name of Allofusicoccin? |
| A: The English name of Allofusicoccin is Allofusicoccin. |