[chloromethyl(propan-2-yloxy)phosphinothioyl] dipropan-2-yl phosphate structure
|
Common Name | [chloromethyl(propan-2-yloxy)phosphinothioyl] dipropan-2-yl phosphate | ||
|---|---|---|---|---|
| CAS Number | 3818-80-2 | Molecular Weight | 352.75200 | |
| Density | 1.225g/cm3 | Boiling Point | 350.6ºC at 760 mmHg | |
| Molecular Formula | C10H23ClO5P2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.9ºC | |
| Name | [chloromethyl(propan-2-yloxy)phosphinothioyl] dipropan-2-yl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 350.6ºC at 760 mmHg |
| Molecular Formula | C10H23ClO5P2S |
| Molecular Weight | 352.75200 |
| Flash Point | 165.9ºC |
| Exact Mass | 352.04300 |
| PSA | 105.70000 |
| LogP | 5.54250 |
| Index of Refraction | 1.475 |
| InChIKey | BJVZHILYTYOYAW-UHFFFAOYSA-N |
| SMILES | CC(C)OP(=O)(OC(C)C)OP(=S)(CCl)OC(C)C |
| Phosphonothioic acid,(chloromethyl)-,O-isopropyl ester,anhydride with diisopropylphosphate |
| ENT 25,757 |
| Bis(1-methylethyl)phosphate anhydride with O-(1-methylethyl)(chloromethyl)phosphonothioate |
| Stauffer B-8760 |
| (chloromethyl-isopropoxy-phosphinothioyl) diisopropyl phosphate |
| B 8760 |