3,3,3-trifluoro-2-(trifluoromethyl)propanoyl chloride structure
|
Common Name | 3,3,3-trifluoro-2-(trifluoromethyl)propanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 382-19-4 | Molecular Weight | 214.49400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4HClF6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3,3-trifluoro-2-(trifluoromethyl)propanoyl chloride |
|---|
| Molecular Formula | C4HClF6O |
|---|---|
| Molecular Weight | 214.49400 |
| Exact Mass | 213.96200 |
| PSA | 17.07000 |
| LogP | 2.49260 |
| InChIKey | AZKSSGUJWJNPPY-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(C(F)(F)F)C(F)(F)F |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |