Benzenamine,2-(ethylsulfonyl)-5-(trifluoromethyl)- structure
|
Common Name | Benzenamine,2-(ethylsulfonyl)-5-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 382-85-4 | Molecular Weight | 253.24100 | |
| Density | 1.379g/cm3 | Boiling Point | 369.6ºC at 760mmHg | |
| Molecular Formula | C9H10F3NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.3ºC | |
| Name | 2-ethylsulfonyl-5-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.379g/cm3 |
|---|---|
| Boiling Point | 369.6ºC at 760mmHg |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.24100 |
| Flash Point | 177.3ºC |
| Exact Mass | 253.03800 |
| PSA | 68.54000 |
| LogP | 3.74320 |
| Index of Refraction | 1.494 |
| InChIKey | BSSGSFJFQBQCFO-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)c1ccc(C(F)(F)F)cc1N |
| HS Code | 2921420090 |
|---|
|
~%
Benzenamine,2-(... CAS#:382-85-4 |
| Literature: Gen. Aniline Works Patent: US1939416 , 1933 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 6-Aethylsulfon-3-trifluormethyl-anilin |
| 2-ethanesulfonyl-5-trifluoromethyl-aniline |
| 2-Aethansulfonyl-5-trifluormethyl-anilin |