diethyl[2-[3-(p-methoxyphenyl)-2-phenylpropionyloxy]ethyl]ammonium chloride structure
|
Common Name | diethyl[2-[3-(p-methoxyphenyl)-2-phenylpropionyloxy]ethyl]ammonium chloride | ||
|---|---|---|---|---|
| CAS Number | 3820-14-2 | Molecular Weight | 391.93200 | |
| Density | N/A | Boiling Point | 459ºC at 760mmHg | |
| Molecular Formula | C22H30ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.4ºC | |
| Name | 2-(diethylamino)ethyl 3-(4-methoxyphenyl)-2-phenylpropanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 459ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H30ClNO3 |
| Molecular Weight | 391.93200 |
| Flash Point | 231.4ºC |
| Exact Mass | 391.19100 |
| PSA | 38.77000 |
| LogP | 4.70850 |
| InChIKey | ONSDBVPINMGIBB-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C(Cc1ccc(OC)cc1)c1ccccc1.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-diethylaminoethyl 3-(4-methoxyphenyl)-2-phenylpropanoate hydrochloride |
| EINECS 223-314-1 |
| Diethyl(2-(3-(p-methoxyphenyl)-2-phenylpropionyloxy)ethyl)ammoniumchloride |
| Propionic acid,3-(p-methoxyphenyl)-2-phenyl-,2-(diethylamino)ethyl ester hydrochloride |