3,7-bis(1-methyl-1-phenylethyl)-10H-phenothiazine structure
|
Common Name | 3,7-bis(1-methyl-1-phenylethyl)-10H-phenothiazine | ||
|---|---|---|---|---|
| CAS Number | 38201-66-0 | Molecular Weight | 435.62300 | |
| Density | 1.122g/cm3 | Boiling Point | 575.5ºC at 760mmHg | |
| Molecular Formula | C30H29NS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.9ºC | |
| Name | 3,7-bis(2-phenylpropan-2-yl)-10H-phenothiazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 575.5ºC at 760mmHg |
| Molecular Formula | C30H29NS |
| Molecular Weight | 435.62300 |
| Flash Point | 301.9ºC |
| Exact Mass | 435.20200 |
| PSA | 37.33000 |
| LogP | 8.68460 |
| Index of Refraction | 1.623 |
| InChIKey | ZKMLFEHQOYQZCB-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccccc1)c1ccc2c(c1)Sc1cc(C(C)(C)c3ccccc3)ccc1N2 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,7-Bis(a,a-dimethylbenzyl)phenothiazine |
| EINECS 253-822-9 |
| 3,7-bis-(1-methyl-1-phenyl-ethyl)-10H-phenothiazine |
| 10H-Phenothiazine,3,7-bis(1-methyl-1-phenylethyl) |
| 3,7-Di(a,a-dimethylbenzyl)phenothiazine |