(2-BROMO-4,6-DIMETHYLPHENOXY)ACETICACID structure
|
Common Name | (2-BROMO-4,6-DIMETHYLPHENOXY)ACETICACID | ||
|---|---|---|---|---|
| CAS Number | 38206-98-3 | Molecular Weight | 259.09700 | |
| Density | 1.495g/cm3 | Boiling Point | 357.2ºC at 760 mmHg | |
| Molecular Formula | C10H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | 2-(2-bromo-4,6-dimethylphenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.495g/cm3 |
|---|---|
| Boiling Point | 357.2ºC at 760 mmHg |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.09700 |
| Flash Point | 169.8ºC |
| Exact Mass | 257.98900 |
| PSA | 46.53000 |
| LogP | 2.52930 |
| Index of Refraction | 1.565 |
| InChIKey | XISIDZGSQIHSIK-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(OCC(=O)O)c(Br)c1 |
| HS Code | 2918990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2-Bromo-4,6-dimethylphenoxy)acetic acid |
| O-(6-Brom-2.4-dimethyl-phenyl)-glykolsaeure |
| (2-Brom-4,6-dimethyl-phenoxy)-essigsaeure |