AKOS AU36-M266 structure
|
Common Name | AKOS AU36-M266 | ||
|---|---|---|---|---|
| CAS Number | 38210-84-3 | Molecular Weight | 238.23700 | |
| Density | 1.212g/cm3 | Boiling Point | 425.1ºC at 760 mmHg | |
| Molecular Formula | C12H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.3ºC | |
| Name | 2-(2-acetyl-4,5-dimethoxyphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 425.1ºC at 760 mmHg |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.23700 |
| Flash Point | 164.3ºC |
| Exact Mass | 238.08400 |
| PSA | 72.83000 |
| LogP | 1.53350 |
| Index of Refraction | 1.53 |
| InChIKey | JRDKNLFTQJPDDA-UHFFFAOYSA-N |
| SMILES | COc1cc(CC(=O)O)c(C(C)=O)cc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| o-acetylphenylacetic acid |
| 2-acetyl-4,5-dimethophenylacetic acid |
| 2-acetyl homoveratric acid |