(E)-7-ethoxy-1-(4-ethylphenoxy)-3,7-dimethyl-oct-2-ene structure
|
Common Name | (E)-7-ethoxy-1-(4-ethylphenoxy)-3,7-dimethyl-oct-2-ene | ||
|---|---|---|---|---|
| CAS Number | 38236-96-3 | Molecular Weight | 304.46700 | |
| Density | 0.929g/cm3 | Boiling Point | 398.1ºC at 760 mmHg | |
| Molecular Formula | C20H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.1ºC | |
| Name | 1-(7-ethoxy-3,7-dimethyloct-2-enoxy)-4-ethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.929g/cm3 |
|---|---|
| Boiling Point | 398.1ºC at 760 mmHg |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.46700 |
| Flash Point | 131.1ºC |
| Exact Mass | 304.24000 |
| PSA | 18.46000 |
| LogP | 5.55950 |
| Index of Refraction | 1.491 |
| InChIKey | AQGCRTARAHYNAW-SAPNQHFASA-N |
| SMILES | CCOC(C)(C)CCCC(C)=CCOc1ccc(CC)cc1 |
| HS Code | 2909309090 |
|---|
|
~%
(E)-7-ethoxy-1-... CAS#:38236-96-3 |
| Literature: Zoecon Corporation Patent: US4137273 A1, 1979 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (E)-7-ETHOXY-1-(4-ETHYLPHENOXY)-3,7-DIMETHYL-OCT-2-ENE |
| 1-(3',7'-dimethyl-7'-ethoxyoct-2'-enyloxy)-4-ethylbenzene |