2-Propenamide,2-(acetylamino)-3-phenyl- structure
|
Common Name | 2-Propenamide,2-(acetylamino)-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 38243-38-8 | Molecular Weight | 204.22500 | |
| Density | 1.201g/cm3 | Boiling Point | 526.9ºC at 760mmHg | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.4ºC | |
| Name | 2-acetamido-3-phenylprop-2-enamide |
|---|
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 526.9ºC at 760mmHg |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.22500 |
| Flash Point | 272.4ºC |
| Exact Mass | 204.09000 |
| PSA | 72.19000 |
| LogP | 1.74010 |
| Index of Refraction | 1.603 |
| InChIKey | CGSKTFVSAVYFAX-YFHOEESVSA-N |
| SMILES | CC(=O)NC(=Cc1ccccc1)C(N)=O |
|
~%
2-Propenamide,2... CAS#:38243-38-8 |
| Literature: Rothstein Journal of the Chemical Society, 1949 , p. 1968,1971 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |