p-(4,5-dihydro-3,4-dimethyl-5-oxo-1H-pyrazol-1-yl)benzenesulphonic acid structure
|
Common Name | p-(4,5-dihydro-3,4-dimethyl-5-oxo-1H-pyrazol-1-yl)benzenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 38254-74-9 | Molecular Weight | 268.28900 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3,4-dimethyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.28900 |
| Exact Mass | 268.05200 |
| PSA | 95.42000 |
| LogP | 1.87330 |
| Index of Refraction | 1.651 |
| InChIKey | VFNOFXXKKALBEP-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1C |
| HS Code | 2933199090 |
|---|
|
~%
p-(4,5-dihydro-... CAS#:38254-74-9 |
| Literature: Walker American Chemical Journal, 1894 , vol. 16, p. 442 |
|
~%
p-(4,5-dihydro-... CAS#:38254-74-9 |
| Literature: Walker American Chemical Journal, 1894 , vol. 16, p. 442 |
|
~%
p-(4,5-dihydro-... CAS#:38254-74-9 |
| Literature: Walker American Chemical Journal, 1894 , vol. 16, p. 442 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(3,4-dimethyl-5-oxo-4,5-dihydro-pyrazol-1-yl)-benzenesulfonic acid |
| 4-(3,4-dimethyl-5-oxo-2,5-dihydro-pyrazol-1-yl)-benzenesulfonic acid |
| p-(4,5-dihydro-3,4-dimethyl-5-oxo-1H-pyrazol-1-yl)benzenesulfonic acid |
| 3,4-Dimethyl-1-(4-sulfo-phenyl)-pyrazol-5-on |
| 4-(3,4-Dimethyl-5-oxo-4,5-dihydro-pyrazol-1-yl)-benzolsulfonsaeure |
| 3,4-Dimethyl-1-(4-sulfophenyl)pyrazol-5-one |
| 3,4-Dimethyl-1-(4-sulfophenyl)pyrazol-5(4H)-one |
| 4-(3,4-dimethyl-5-oxo-4,5-dihydro-1h-pyrazol-1-yl)benzenesulfonic acid |