Isololiolide structure
|
Common Name | Isololiolide | ||
|---|---|---|---|---|
| CAS Number | 38274-00-9 | Molecular Weight | 196.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Isololiolide(+)-Epiloliolide is a megastigmane that can be isolated from Annona muricata[1]. |
| Name | (+)-Isololiolide |
|---|
| Description | (+)-Epiloliolide is a megastigmane that can be isolated from Annona muricata[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H16O3 |
|---|---|
| Molecular Weight | 196.24 |
| InChIKey | XEVQXKKKAVVSMW-CPCISQLKSA-N |
| SMILES | CC1(C)CC(O)CC2(C)OC(=O)C=C12 |