1-[4-[2-(diethylamino)ethoxy]phenyl]-2-(4-fluorophenyl)-1-(4-methylphenyl)ethanol structure
|
Common Name | 1-[4-[2-(diethylamino)ethoxy]phenyl]-2-(4-fluorophenyl)-1-(4-methylphenyl)ethanol | ||
|---|---|---|---|---|
| CAS Number | 3828-26-0 | Molecular Weight | 421.54700 | |
| Density | 1.113g/cm3 | Boiling Point | 529.5ºC at 760 mmHg | |
| Molecular Formula | C27H32FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274ºC | |
| Name | 1-[4-[2-(diethylamino)ethoxy]phenyl]-2-(4-fluorophenyl)-1-(4-methylphenyl)ethanol |
|---|
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 529.5ºC at 760 mmHg |
| Molecular Formula | C27H32FNO2 |
| Molecular Weight | 421.54700 |
| Flash Point | 274ºC |
| Exact Mass | 421.24200 |
| PSA | 32.70000 |
| LogP | 5.33330 |
| Index of Refraction | 1.569 |
| InChIKey | JLKUTPTYHNEUSP-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1ccc(C(O)(Cc2ccc(F)cc2)c2ccc(C)cc2)cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |