7-[2-[bis(2-hydroxyethyl)amino]ethyl]-1,3-dimethylpurine-2,6-dione structure
|
Common Name | 7-[2-[bis(2-hydroxyethyl)amino]ethyl]-1,3-dimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 38285-26-6 | Molecular Weight | 311.33700 | |
| Density | 1.41g/cm3 | Boiling Point | 596.7ºC at 760 mmHg | |
| Molecular Formula | C13H21N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.6ºC | |
| Name | 7-[2-[bis(2-hydroxyethyl)amino]ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 596.7ºC at 760 mmHg |
| Molecular Formula | C13H21N5O4 |
| Molecular Weight | 311.33700 |
| Flash Point | 314.6ºC |
| Exact Mass | 311.15900 |
| PSA | 105.52000 |
| Index of Refraction | 1.639 |
| InChIKey | KRBHNUALJIYPDN-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CCN(CCO)CCO)n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-[2-[bis(2-hydroxyethyl)amino]ethyl]-1,3-dimethylxanthine |
| Vephylline |
| G-111 Tartrate |
| 7-<ss-(ss,ss'-Dihydroxydiethyl)-aminoethyl>-theophyllin |
| 7-{2-[bis-(2-hydroxy-ethyl)-amino]-ethyl}-1,3-dimethyl-3,7-dihydro-purine-2,6-dione |
| 1H-Purine-2,6-dione,7-(2-(bis(2-hydroxyethyl)amino)ethyl)-3,7-dihydro-1,3-dimethyl |
| 7-(2-Bis(2-hydroxyethyl)aminoethyl)theophylline |
| G 112 |
| 7-{2-[Bis-(2-hydroxy-aethyl)-amino]-aethyl}-1,3-dimethyl-3,7-dihydro-purin-2,6-dion |
| G 111 |