methyl naphtho[2,1-f][1,3]benzodioxole-5-carboxylate
Modify Date: 2025-08-20 11:46:41
![methyl naphtho[2,1-f][1,3]benzodioxole-5-carboxylate Structure](https://image.chemsrc.com/caspic/089/38288-34-5.png)
methyl naphtho[2,1-f][1,3]benzodioxole-5-carboxylate structure
|
Common Name | methyl naphtho[2,1-f][1,3]benzodioxole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 38288-34-5 | Molecular Weight | 280.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl naphtho[2,1-f][1,3]benzodioxole-5-carboxylate |
|---|
| Molecular Formula | C17H12O4 |
|---|---|
| Molecular Weight | 280.27500 |
| Exact Mass | 280.07400 |
| PSA | 44.76000 |
| LogP | 3.50830 |
| InChIKey | ZKIIVJXMUUGCAL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cc3c(cc2c2ccccc12)OCO3 |
|
~%
methyl naphtho[... CAS#:38288-34-5 |
| Literature: Mosettig; Burger Journal of the American Chemical Society, 1930 , vol. 52, p. 2988,2992 |
![{Phenanthro[2,3-d][1,3]dioxole-5-carboxylic} acid structure](https://image.chemsrc.com/caspic/127/38288-33-4.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |