2,4-dinitro-N-[(2-phenoxy-1-phenyl-ethylidene)amino]aniline structure
|
Common Name | 2,4-dinitro-N-[(2-phenoxy-1-phenyl-ethylidene)amino]aniline | ||
|---|---|---|---|---|
| CAS Number | 38293-78-6 | Molecular Weight | 392.36500 | |
| Density | 1.32g/cm3 | Boiling Point | 568.3ºC at 760 mmHg | |
| Molecular Formula | C20H16N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.5ºC | |
| Name | 2,4-dinitro-N-[(2-phenoxy-1-phenylethylidene)amino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 568.3ºC at 760 mmHg |
| Molecular Formula | C20H16N4O5 |
| Molecular Weight | 392.36500 |
| Flash Point | 297.5ºC |
| Exact Mass | 392.11200 |
| PSA | 125.26000 |
| LogP | 5.51760 |
| Index of Refraction | 1.635 |
| InChIKey | FGTRYDSNXYDDDD-ZBJSNUHESA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=C(COc2ccccc2)c2ccccc2)c([N+](=O)[O-])c1 |
|
~%
2,4-dinitro-N-[... CAS#:38293-78-6 |
| Literature: Guss Journal of the American Chemical Society, 1949 , vol. 71, p. 3460 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-Dioxane,2-phenoxy |
| 2-Phenoxy-1,4-dioxan |