N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol structure
|
Common Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol | ||
|---|---|---|---|---|
| CAS Number | 38294-69-8 | Molecular Weight | 467.04400 | |
| Density | N/A | Boiling Point | 400.8ºC at 760mmHg | |
| Molecular Formula | C24H39ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine,2-(chloromethyl)oxirane,4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 400.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C24H39ClN4O3 |
| Molecular Weight | 467.04400 |
| Exact Mass | 466.27100 |
| PSA | 129.09000 |
| LogP | 4.31310 |
| InChIKey | DUYOAVQDASZIIB-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.ClCC1CO1.NCCNCCNCCN |
| RIDADR | UN 1760 |
|---|---|
| Packaging Group | III |
| Phenol,4,4'-(1-methylethylidene)bis-,polymer with N,N'-bis(2-aminoethyl)-1,2-ethanediamine and (chloromethyl)oxirane |
| Bisphenol A,epichlorohydrin,triethylenetetramine polymer |