8-Chloro-1,2,3,4-tetrahydro-1-[(4-methylphenyl)sulfonyl]-5H-1-benzazepin-5-one structure
|
Common Name | 8-Chloro-1,2,3,4-tetrahydro-1-[(4-methylphenyl)sulfonyl]-5H-1-benzazepin-5-one | ||
|---|---|---|---|---|
| CAS Number | 38314-49-7 | Molecular Weight | 349.83200 | |
| Density | 1.36g/cm3 | Boiling Point | 535.3ºC at 760 mmHg | |
| Molecular Formula | C17H16ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.5ºC | |
| Name | 8-chloro-1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-1-benzazepin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 535.3ºC at 760 mmHg |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.83200 |
| Flash Point | 277.5ºC |
| Exact Mass | 349.05400 |
| PSA | 62.83000 |
| LogP | 4.96600 |
| Index of Refraction | 1.619 |
| InChIKey | RAQRQCRSBMXYER-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(=O)c3ccc(Cl)cc32)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-chloro-5-oxo-2,3,4,5-tetrahydro-1-p-toluenesulfonyl-1H-1-benzazepine |
| 8-Chlor-1,2,3,4-tetrahydro-1-p-tolylsulfonyl-1-benzazepin-5-on |