1-(3,4-dimethoxyphenoxy)-2-methoxy-5-methyl-4-nitro-benzene structure
|
Common Name | 1-(3,4-dimethoxyphenoxy)-2-methoxy-5-methyl-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 38314-81-7 | Molecular Weight | 319.30900 | |
| Density | 1.227g/cm3 | Boiling Point | 427.2ºC at 760 mmHg | |
| Molecular Formula | C16H17NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.1ºC | |
| Name | 1-(3,4-dimethoxyphenoxy)-2-methoxy-5-methyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 427.2ºC at 760 mmHg |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.30900 |
| Flash Point | 169.1ºC |
| Exact Mass | 319.10600 |
| PSA | 82.74000 |
| LogP | 4.24450 |
| Index of Refraction | 1.559 |
| InChIKey | KYULMJHUGKIQLS-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2cc(C)c([N+](=O)[O-])cc2OC)cc1OC |
|
~%
1-(3,4-dimethox... CAS#:38314-81-7 |
| Literature: Kupchan; Liepa; Kameswaran; Sempuku Journal of the American Chemical Society, 1973 , vol. 95, # 9 p. 2995 - 3000 |
|
~%
1-(3,4-dimethox... CAS#:38314-81-7 |
| Literature: Kupchan; Liepa; Kameswaran; Sempuku Journal of the American Chemical Society, 1973 , vol. 95, # 9 p. 2995 - 3000 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,3',4'-Trimethoxy-5-methyl-4-nitrodiphenyl-ether |
| 5-(3,4-Dimethyl-phenoxy)-4-methoxy-2-nitrotoluol |