2,5-dichloro-3,6-dimethyl-benzoic acid structure
|
Common Name | 2,5-dichloro-3,6-dimethyl-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 38319-81-2 | Molecular Weight | 219.06500 | |
| Density | 1.382g/cm3 | Boiling Point | 329.2ºC at 760 mmHg | |
| Molecular Formula | C9H8Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.9ºC | |
| Name | 2,5-dichloro-3,6-dimethylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 329.2ºC at 760 mmHg |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.06500 |
| Flash Point | 152.9ºC |
| Exact Mass | 217.99000 |
| PSA | 37.30000 |
| LogP | 3.30840 |
| Index of Refraction | 1.578 |
| InChIKey | MXCLKQOSGWYNNM-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c(C)c(C(=O)O)c1Cl |
|
~%
2,5-dichloro-3,... CAS#:38319-81-2 |
| Literature: Nakamura,N.; Oki,M. Bulletin of the Chemical Society of Japan, 1972 , vol. 45, p. 2565 - 2570 |
|
~%
2,5-dichloro-3,... CAS#:38319-81-2 |
| Literature: Nakamura,N.; Oki,M. Bulletin of the Chemical Society of Japan, 1972 , vol. 45, p. 2565 - 2570 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,5-Dichloro-3,6-dimethylbenzoesaeure |