ethyl 6-chloro-4-oxo-chromene-2-carboxylate structure
|
Common Name | ethyl 6-chloro-4-oxo-chromene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 38322-69-9 | Molecular Weight | 252.65000 | |
| Density | 1.394g/cm3 | Boiling Point | 368.2ºC at 760 mmHg | |
| Molecular Formula | C12H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.1ºC | |
| Name | ethyl 6-chloro-4-oxochromene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 368.2ºC at 760 mmHg |
| Molecular Formula | C12H9ClO4 |
| Molecular Weight | 252.65000 |
| Flash Point | 156.1ºC |
| Exact Mass | 252.01900 |
| PSA | 56.51000 |
| LogP | 2.62310 |
| Index of Refraction | 1.579 |
| InChIKey | JKMIKRDROJBJMP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(=O)c2cc(Cl)ccc2o1 |
| HS Code | 2918300090 |
|---|
|
~69%
ethyl 6-chloro-... CAS#:38322-69-9 |
| Literature: Helguera, Aliuska Morales; Perez-Garrido, Alfonso; Gaspar, Alexandra; Reis, Joana; Cagide, Fernando; Vina, Dolores; Cordeiro, M.Natalia D.S.; Borges, Fernanda European Journal of Medicinal Chemistry, 2013 , vol. 59, p. 75 - 90 |
|
~%
ethyl 6-chloro-... CAS#:38322-69-9 |
| Literature: DAIICHI PHARMACEUTICAL CO., LTD. Patent: US2005/20645 A1, 2005 ; |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 6-chloro-4-oxo-4H-chromene-2-carboxylate |
| 6-chloro-4-oxo-4H-chromene-2-carboxylic acid ethyl ester |
| Ethyl-6-chlorchromon-2-carboxylat |
| 4H-1-Benzopyran-2-carboxylic acid,6-chloro-4-oxo-,ethyl ester |
| 6-Chlor-chromon-carbonsaeure-(2)-aethylester |
| Ethyl 6-chloro-4-oxo-4H-1-benzopyran-2-carboxylate |