1-Anthracenecarboxylicacid, 9,10-dihydro-8-hydroxy-9,10-dioxo structure
|
Common Name | 1-Anthracenecarboxylicacid, 9,10-dihydro-8-hydroxy-9,10-dioxo | ||
|---|---|---|---|---|
| CAS Number | 38366-35-7 | Molecular Weight | 268.22100 | |
| Density | 1.577g/cm3 | Boiling Point | 550.6ºC at 760mmHg | |
| Molecular Formula | C15H8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.8ºC | |
| Name | 8-hydroxy-9,10-dioxoanthracene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.577g/cm3 |
|---|---|
| Boiling Point | 550.6ºC at 760mmHg |
| Molecular Formula | C15H8O5 |
| Molecular Weight | 268.22100 |
| Flash Point | 300.8ºC |
| Exact Mass | 268.03700 |
| PSA | 91.67000 |
| LogP | 1.86580 |
| Index of Refraction | 1.724 |
| InChIKey | YDJMJBJEOLHHCN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2c1C(=O)c1c(O)cccc1C2=O |
|
~%
1-Anthracenecar... CAS#:38366-35-7 |
| Literature: Golden,R.; Stock,L.M. Journal of the American Chemical Society, 1972 , vol. 94, # 9 p. 3080 - 3088 |
|
~%
1-Anthracenecar... CAS#:38366-35-7 |
| Literature: Golden,R.; Stock,L.M. Journal of the American Chemical Society, 1972 , vol. 94, # 9 p. 3080 - 3088 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-hydroxy-9,10-dioxo-9,10-dihydroanthracene-1-carboxylic acid |