N-(3-hydrazinyl-3-oxopropyl)benzenesulfonamide structure
|
Common Name | N-(3-hydrazinyl-3-oxopropyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 38378-06-2 | Molecular Weight | 243.28300 | |
| Density | 1.331g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H13N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-hydrazinyl-3-oxopropyl)benzenesulfonamide |
|---|
| Density | 1.331g/cm3 |
|---|---|
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.28300 |
| Exact Mass | 243.06800 |
| PSA | 113.16000 |
| LogP | 2.35720 |
| Index of Refraction | 1.576 |
| InChIKey | FWRAKTYNLUIKMJ-UHFFFAOYSA-N |
| SMILES | NNC(=O)CCNS(=O)(=O)c1ccccc1 |
| HS Code | 2935009090 |
|---|
|
~%
N-(3-hydrazinyl... CAS#:38378-06-2 |
| Literature: Fan, Chenguang; Vederas, John C. Organic and Biomolecular Chemistry, 2012 , vol. 10, # 30 p. 5815 - 5819 |
|
~%
N-(3-hydrazinyl... CAS#:38378-06-2 |
| Literature: Fan, Chenguang; Vederas, John C. Organic and Biomolecular Chemistry, 2012 , vol. 10, # 30 p. 5815 - 5819 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |