4-methyl-3-(4-methylphenyl)oxadiazol-3-ium-5-olate structure
|
Common Name | 4-methyl-3-(4-methylphenyl)oxadiazol-3-ium-5-olate | ||
|---|---|---|---|---|
| CAS Number | 3838-04-8 | Molecular Weight | 190.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-3-(4-methylphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10N2O2 |
|---|---|
| Molecular Weight | 190.19900 |
| Exact Mass | 190.07400 |
| PSA | 48.03000 |
| LogP | 1.44230 |
| InChIKey | OFEBTTBEFIUFJB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-[n+]2noc([O-])c2C)cc1 |
| HS Code | 2934999090 |
|---|
|
~%
4-methyl-3-(4-m... CAS#:3838-04-8 |
| Literature: Hammick,D.L.; Voaden,D.J. Journal of the Chemical Society, 1961 , p. 3303 - 3308 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-methyl-3-p-tolyl-sydnone |
| N-(p-Tolyl)-C-(methyl)-sydnon |
| Sydnone,4-methyl-3-(p-tolyl) |
| N-(p-Tolyl)-C-(methyl)-sydnon [German] |
| Sydnone,4-methyl-3-(4-methylphenyl) |
| 3-(p-Tolyl)-4-methyl-sydnon |