6-chloro-1-nitronaphthalene structure
|
Common Name | 6-chloro-1-nitronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 38396-29-1 | Molecular Weight | 207.61300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-1-nitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H6ClNO2 |
|---|---|
| Molecular Weight | 207.61300 |
| Exact Mass | 207.00900 |
| PSA | 45.82000 |
| LogP | 3.92460 |
| InChIKey | ALQUEFFIWUNSDY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc2cc(Cl)ccc12 |
|
~%
6-chloro-1-nitr... CAS#:38396-29-1 |
| Literature: Hodgson; Turner Journal of the Chemical Society, 1942 , p. 723 Journal of the Chemical Society, 1943 , p. 704 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1-Nitro-6-chloronaphthalene |
| 2-Chlor-5-nitronaphthalin |
| 6-chloro-1-nitro-naphthalene |
| 6-Chlor-1-nitro-naphthalin |
| 1-Nitro-6-chlornaphthalin |
| Naphthalene,6-chloro-1-nitro |