(4-methylphenyl)methyl benzoate structure
|
Common Name | (4-methylphenyl)methyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 38418-10-9 | Molecular Weight | 226.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methylphenyl)methyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O2 |
|---|---|
| Molecular Weight | 226.27000 |
| Exact Mass | 226.09900 |
| PSA | 26.30000 |
| LogP | 3.35200 |
| InChIKey | VHSYVZKRJCCJMK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(COC(=O)c2ccccc2)cc1 |
| HS Code | 2916310090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
Name: Cytotoxicity against HEK293T cells expressing HA-tagged mouse AT1a angiotensin 2 rece...
Source: ChEMBL
Target: N/A
External Id: CHEMBL998775
|
|
Name: Antagonist activity at HA-tagged mouse AT1a angiotensin 2 receptor expressed in HEK29...
Source: ChEMBL
Target: Type-1A angiotensin II receptor
External Id: CHEMBL998774
|
| Benzenemethanol,benzoate |
| 4-Methylbenzylbenzoat |
| p-methylbenzyl benzoate |
| Benzenemethanol,4-methyl-,benzoate |
| benzoic acid-(4-methyl-benzyl ester) |
| Benzoesaeure-<4-methyl-benzylester> |
| 4-Methylbenzyl benzoate |