2-chloro-N-[(4-nitrophenyl)methyl]acetamide
Modify Date: 2025-09-21 11:23:53
![2-chloro-N-[(4-nitrophenyl)methyl]acetamide Structure](https://image.chemsrc.com/caspic/409/38426-11-8.png)
2-chloro-N-[(4-nitrophenyl)methyl]acetamide structure
|
Common Name | 2-chloro-N-[(4-nitrophenyl)methyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 38426-11-8 | Molecular Weight | 228.63200 | |
| Density | 1.361g/cm3 | Boiling Point | 474.6ºC at 760 mmHg | |
| Molecular Formula | C9H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.8ºC | |
| Name | 2-chloro-N-[(4-nitrophenyl)methyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 474.6ºC at 760 mmHg |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63200 |
| Flash Point | 240.8ºC |
| Exact Mass | 228.03000 |
| PSA | 74.92000 |
| LogP | 2.36390 |
| Index of Refraction | 1.574 |
| InChIKey | VFBUDPDUPLYXIC-UHFFFAOYSA-N |
| SMILES | O=C(CCl)NCc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
|
~76%
2-chloro-N-[(4-... CAS#:38426-11-8 |
| Literature: Zhang, Mingming; Zhu, Weiliang; Li, Yingxia European Journal of Medicinal Chemistry, 2013 , vol. 62, p. 301 - 310 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Chlor-essigsaeure-(4-nitro-benzylamid) |
| C-Chlor-N-(4-nitro-benzyl)-acetamid |
| chloro-acetic acid-(4-nitro-benzylamide) |
| 2-chloro-n-(4-nitrobenzyl)acetamide |