2-[3-[[1-(4,5-dihydro-1,3-thiazol-2-yl)azetidin-3-yl]disulfanyl]azetidin-1-yl]-4,5-dihydro-1,3-thiazole structure
|
Common Name | 2-[3-[[1-(4,5-dihydro-1,3-thiazol-2-yl)azetidin-3-yl]disulfanyl]azetidin-1-yl]-4,5-dihydro-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 384330-54-5 | Molecular Weight | 346.55800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N4S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[3-[[1-(4,5-dihydro-1,3-thiazol-2-yl)azetidin-3-yl]disulfanyl]azetidin-1-yl]-4,5-dihydro-1,3-thiazole |
|---|
| Molecular Formula | C12H18N4S4 |
|---|---|
| Molecular Weight | 346.55800 |
| Exact Mass | 346.04100 |
| PSA | 132.40000 |
| LogP | 0.68880 |
| InChIKey | IGDMWMBDLXBZEZ-UHFFFAOYSA-N |
| SMILES | C1CSC(N2CC(SSC3CN(C4=NCCS4)C3)C2)=N1 |
| HS Code | 2934100090 |
|---|
|
~91%
2-[3-[[1-(4,5-d... CAS#:384330-54-5 |
| Literature: Isoda, Takeshi; Yamamura, Itsuki; Tamai, Satoshi; Kumagai, Toshio; Nagao, Yoshimitsu Chemical and Pharmaceutical Bulletin, 2006 , vol. 54, # 10 p. 1408 - 1411 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |