4-(Hexyloxy)benzoic acid 4-butylphenyl ester structure
|
Common Name | 4-(Hexyloxy)benzoic acid 4-butylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 38444-08-5 | Molecular Weight | 354.48300 | |
| Density | 1.026g/cm3 | Boiling Point | 479.6ºC at 760 mmHg | |
| Molecular Formula | C23H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.7ºC | |
| Name | (4-butylphenyl) 4-hexoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.026g/cm3 |
|---|---|
| Boiling Point | 479.6ºC at 760 mmHg |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.48300 |
| Flash Point | 206.7ºC |
| Exact Mass | 354.21900 |
| PSA | 35.53000 |
| LogP | 6.20750 |
| Index of Refraction | 1.529 |
| InChIKey | JLKUBJNRCXUXLY-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(CCCC)cc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Butylphenyl-4'-hexyloxybenzoat |
| p-n-Butylphenyl-p'-n-hexylbenzoat |
| Benzoic acid,4-(hexyloxy)-,4-butylphenyl ester |
| 4-Butylphenyl 4-hexyloxybenzoate |
| p-Hexyloxybenzoesaeure-p'-butylphenylester |