2,3',6-Trichloro-1,1'-biphenyl structure
|
Common Name | 2,3',6-Trichloro-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 38444-76-7 | Molecular Weight | 257.54300 | |
| Density | 1.351g/cm3 | Boiling Point | 319.6ºC at 760mmHg | |
| Molecular Formula | C12H7Cl3 | Melting Point | 63.91°C (estimate) | |
| MSDS | N/A | Flash Point | 217.8ºC | |
| Name | 2,3',6-Trichlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 319.6ºC at 760mmHg |
| Melting Point | 63.91°C (estimate) |
| Molecular Formula | C12H7Cl3 |
| Molecular Weight | 257.54300 |
| Flash Point | 217.8ºC |
| Exact Mass | 255.96100 |
| LogP | 5.31380 |
| Index of Refraction | 1.603 |
| InChIKey | VQOFJPFYTCHPTR-UHFFFAOYSA-N |
| SMILES | Clc1cccc(-c2c(Cl)cccc2Cl)c1 |
| HS Code | 2903999090 |
|---|
|
~%
2,3',6-Trichlor... CAS#:38444-76-7 |
| Literature: Bolgar; et al. Chemosphere, 1995 , vol. 31, # 2 p. 2687 - 2705 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3-dichloro-2-(3-chlorophenyl)benzene |