4-(Hexyloxy)phenyl 4-butylbenzoate structure
|
Common Name | 4-(Hexyloxy)phenyl 4-butylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 38454-28-3 | Molecular Weight | 354.483 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 479.6±38.0 °C at 760 mmHg | |
| Molecular Formula | C23H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.7±21.4 °C | |
| Name | 4-(Hexyloxy)phenyl 4-Butylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 479.6±38.0 °C at 760 mmHg |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.483 |
| Flash Point | 206.7±21.4 °C |
| Exact Mass | 354.219482 |
| PSA | 35.53000 |
| LogP | 8.42 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.530 |
| InChIKey | QZYDWVAYBOXUCW-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1ccc(OC(=O)c2ccc(CCCC)cc2)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
4-(Hexyloxy)phe... CAS#:38454-28-3 |
| Literature: Steinstraesser,R. Z. Naturforsch., B: Anorg. Chem., Org. Chem., Biochem., Biophys.,, 1972 , vol. 27, p. 774 - 779 |
|
~%
4-(Hexyloxy)phe... CAS#:38454-28-3 |
| Literature: Steinstraesser,R. Z. Naturforsch., B: Anorg. Chem., Org. Chem., Biochem., Biophys.,, 1972 , vol. 27, p. 774 - 779 |
|
~%
4-(Hexyloxy)phe... CAS#:38454-28-3 |
| Literature: Steinstraesser,R. Z. Naturforsch., B: Anorg. Chem., Org. Chem., Biochem., Biophys.,, 1972 , vol. 27, p. 774 - 779 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (4-hexoxyphenyl) 4-butylbenzoate |
| 4-N-BUTYLBENZOIC ACID 4'-N-HEXYLOXYPHENYL ESTER |
| 4-Butylbenzoic Acid 4-(Hexyloxy)phenyl Ester |
| Benzoic acid, 4-butyl-, 4-(hexyloxy)phenyl ester |
| 4-(Hexyloxy)phenyl 4-butylbenzoate |