1,3-Cyclohexanedione,2-(diaminomethylene)-5,5-dimethyl-(9CI) structure
|
Common Name | 1,3-Cyclohexanedione,2-(diaminomethylene)-5,5-dimethyl-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 384811-20-5 | Molecular Weight | 182.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(Diaminomethylene)-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H14N2O2 |
|---|---|
| Molecular Weight | 182.22000 |
| Exact Mass | 182.10600 |
| PSA | 86.18000 |
| LogP | 1.47420 |
| InChIKey | HCTPKIQCDIPNRH-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C(C(=N)N)=C(O)C1 |
| HS Code | 2922399090 |
|---|
|
~96%
1,3-Cyclohexane... CAS#:384811-20-5 |
| Literature: Voronkova; Komkov; Shashkov; Dorokhov Russian Chemical Bulletin, 2011 , vol. 60, # 1 p. 148 - 152 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-diaminomethylidene-5,5-dimethyl-cyclohexane-1,3-dione |
| 1,3-Cyclohexanedione,2-(diaminomethylene)-5,5-dimethyl-(9CI) |