1,3-dichloro-6-(trifluoromethyl)phenanthren-9-methanol structure
|
Common Name | 1,3-dichloro-6-(trifluoromethyl)phenanthren-9-methanol | ||
|---|---|---|---|---|
| CAS Number | 38492-81-8 | Molecular Weight | 345.14300 | |
| Density | 1.507g/cm3 | Boiling Point | 478.5ºC at 760 mmHg | |
| Molecular Formula | C16H9Cl2F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
| Name | [1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.507g/cm3 |
|---|---|
| Boiling Point | 478.5ºC at 760 mmHg |
| Molecular Formula | C16H9Cl2F3O |
| Molecular Weight | 345.14300 |
| Flash Point | 243.2ºC |
| Exact Mass | 343.99800 |
| PSA | 20.23000 |
| LogP | 5.81090 |
| Index of Refraction | 1.646 |
| InChIKey | ANDPCRISJIJFCB-UHFFFAOYSA-N |
| SMILES | OCc1cc2c(Cl)cc(Cl)cc2c2cc(C(F)(F)F)ccc12 |
| HS Code | 2906299090 |
|---|
|
~%
1,3-dichloro-6-... CAS#:38492-81-8 |
| Literature: Colwell,W.T. et al. Journal of Medicinal Chemistry, 1972 , vol. 15, p. 771 - 775 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 9-Phenanthrenemethanol,1,3-dichloro-6-(trifluoromethyl) |
| 1,3-dichloro-6-(trifluoromethyl)phenanthren-9-methanol |
| EINECS 253-970-4 |
| 1,3-Dichloro-6-trifluoromethyl-9-phenanthrenemethanol |