L-Leucine, N-[N-[(phenylmethoxy)carbonyl]-L-phenylalanyl]-, methyl ester structure
|
Common Name | L-Leucine, N-[N-[(phenylmethoxy)carbonyl]-L-phenylalanyl]-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 3850-45-1 | Molecular Weight | 426.50500 | |
| Density | 1.15g/cm3 | Boiling Point | 618.3ºC at 760 mmHg | |
| Molecular Formula | C24H30N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.7ºC | |
| Name | methyl 4-methyl-2-[[3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 618.3ºC at 760 mmHg |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.50500 |
| Flash Point | 327.7ºC |
| Exact Mass | 426.21500 |
| PSA | 93.73000 |
| LogP | 4.00980 |
| Index of Refraction | 1.545 |
| InChIKey | AWYRARCUKRVSSB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| N-Cbz-(S)-phenylalanine-(2S)-2-amino-4-methylpentanoic acid methyl ester |
| Cbz-Phe-Leu-OMe |
| methyl (2R,3R)-2,3-dideuterio-4-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate |
| N-benzyloxycarbonyl-(S)phenylalanyl-(S)leucine methyl ester |
| methyl n-[(benzyloxy)carbonyl]phenylalanylleucinate |
| N-benzyloxycarbonylated methyl ester of L-phenylalanyl-L-leucine |
| N-Cbz-L-Phe-L-Leu-OMe |
| N-(benzyloxycarbonyl)-L-phenylalanyl-L-leucine methyl ester |