2-Ethyl-2-(o-nitrophenyl)glutarimide structure
|
Common Name | 2-Ethyl-2-(o-nitrophenyl)glutarimide | ||
|---|---|---|---|---|
| CAS Number | 38527-74-1 | Molecular Weight | 262.26100 | |
| Density | 1.263g/cm3 | Boiling Point | 474ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.5ºC | |
| Name | 3-ethyl-3-(2-nitrophenyl)piperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 474ºC at 760 mmHg |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26100 |
| Flash Point | 240.5ºC |
| Exact Mass | 262.09500 |
| PSA | 95.48000 |
| LogP | 2.47830 |
| Index of Refraction | 1.557 |
| InChIKey | FFUZYZRMKNOKJW-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2[N+](=O)[O-])CCC(=O)NC1=O |
| HS Code | 2925190090 |
|---|
|
~%
2-Ethyl-2-(o-ni... CAS#:38527-74-1 |
| Literature: Foster; Jarman; Leung; Rowlands; Taylor Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 50 - 54 |
|
~%
2-Ethyl-2-(o-ni... CAS#:38527-74-1 |
| Literature: CIBA Patent: US2848455 , 1956 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-o-Nitrophenyl-2-ethylglutarimid |
| Glutarimide,2-ethyl-2-(o-nitrophenyl) |
| 3-Aethyl-3-(2-nitro-phenyl)-piperidin-2,6-dion |
| 2-Ethyl-2-(o-nitrophenyl)glutarimide |
| 3-ethyl-3-(2-nitro-phenyl)-piperidine-2,6-dione |
| 2,6-Piperidinedione,3-ethyl-3-(2-nitrophenyl) |
| o-Nitroglutethimide |