1-(ethoxy-propylsulfanyl-phosphoryl)oxy-4-methyl-benzene
Modify Date: 2024-07-18 19:43:36
1-(ethoxy-propylsulfanyl-phosphoryl)oxy-4-methyl-benzene structure
|
Common Name | 1-(ethoxy-propylsulfanyl-phosphoryl)oxy-4-methyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 38527-96-7 | Molecular Weight | 274.31600 | |
| Density | 1.141g/cm3 | Boiling Point | 351.4ºC at 760 mmHg | |
| Molecular Formula | C12H19O3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.3ºC | |
| Name | 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-4-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 351.4ºC at 760 mmHg |
| Molecular Formula | C12H19O3PS |
| Molecular Weight | 274.31600 |
| Flash Point | 166.3ºC |
| Exact Mass | 274.07900 |
| PSA | 70.64000 |
| LogP | 4.66160 |
| Index of Refraction | 1.518 |
| InChIKey | OGSIZYMAFPTPTR-UHFFFAOYSA-N |
| SMILES | CCCSP(=O)(OCC)Oc1ccc(C)cc1 |
| HS Code | 2920190090 |
|---|
| HS Code | 2920190090 |
|---|---|
| Summary | 2920190090 other thiophosphoric esters (phosphorothioates) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| o-ethyl o-(4-methylphenyl) s-propyl phosphorothioate |
| Phosphorothioic acid,O-ethyl O-(4-methylphenyl) S-propyl ester |