1-alpha-H,5-alpha-H-Tropan-3-alpha-ol, 2,2-diphenyl-3-hydroxypropionat e structure
|
Common Name | 1-alpha-H,5-alpha-H-Tropan-3-alpha-ol, 2,2-diphenyl-3-hydroxypropionat e | ||
|---|---|---|---|---|
| CAS Number | 38545-48-1 | Molecular Weight | 365.46500 | |
| Density | 1.21g/cm3 | Boiling Point | 522.6ºC at 760 mmHg | |
| Molecular Formula | C23H27NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.9ºC | |
| Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2,2-diphenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 522.6ºC at 760 mmHg |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.46500 |
| Flash Point | 269.9ºC |
| Exact Mass | 365.19900 |
| PSA | 49.77000 |
| LogP | 3.07130 |
| Index of Refraction | 1.617 |
| InChIKey | LAHZEAWORMLOOB-UHFFFAOYSA-N |
| SMILES | CN1C2CCC1CC(OC(=O)C(CO)(c1ccccc1)c1ccccc1)C2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-hydroxy-2,2-diphenyl-propionic acid tropan-3-yl ester |
| 8-methyl-8-azabicyclo[3.2.1]oct-3-yl 3-hydroxy-2,2-diphenylpropanoate |
| Oxymethyltropacine |