1-[4-(dimethylamino)phenyl]-5-(4-methylphenyl)penta-1,4-dien-3-one structure
|
Common Name | 1-[4-(dimethylamino)phenyl]-5-(4-methylphenyl)penta-1,4-dien-3-one | ||
|---|---|---|---|---|
| CAS Number | 38552-36-2 | Molecular Weight | 291.38700 | |
| Density | 1.09g/cm3 | Boiling Point | 477.8ºC at 760 mmHg | |
| Molecular Formula | C20H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.5ºC | |
| Name | 1-[4-(dimethylamino)phenyl]-5-(4-methylphenyl)penta-1,4-dien-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 477.8ºC at 760 mmHg |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.38700 |
| Flash Point | 186.5ºC |
| Exact Mass | 291.16200 |
| PSA | 20.31000 |
| LogP | 4.35670 |
| Index of Refraction | 1.644 |
| InChIKey | NLERDPHRELGZTH-WFYKWJGLSA-N |
| SMILES | Cc1ccc(C=CC(=O)C=Cc2ccc(N(C)C)cc2)cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(4-(Dimethylamino)phenyl)-5-(4-methylphenyl)penta-1,4-dien-3-one |