1,5-Bis-(3,4-dimethoxyphenyl)-3-pentadienone structure
|
Common Name | 1,5-Bis-(3,4-dimethoxyphenyl)-3-pentadienone | ||
|---|---|---|---|---|
| CAS Number | 38552-39-5 | Molecular Weight | 354.39600 | |
| Density | 1.147g/cm3 | Boiling Point | 533.2ºC at 760 mmHg | |
| Molecular Formula | C21H22O5 | Melting Point | 83-85ºC | |
| MSDS | N/A | Flash Point | 233.3ºC | |
| Name | 1,5-Bis-(3,4-dimethoxyphenyl)-3-pentadienone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 533.2ºC at 760 mmHg |
| Melting Point | 83-85ºC |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.39600 |
| Flash Point | 233.3ºC |
| Exact Mass | 354.14700 |
| PSA | 53.99000 |
| LogP | 4.01670 |
| Index of Refraction | 1.59 |
| InChIKey | BUWQOPHMYRXMLL-NXZHAISVSA-N |
| SMILES | COc1ccc(C=CC(=O)C=Cc2ccc(OC)c(OC)c2)cc1OC |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,5-BIS(3,4-DIMETHOXYPHENYL)-1,4-PENTADIEN-3-ONE |
| 1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-one |