4-chloro-2-oxo-2H-benzothiazole-3-acetic acid, compound with dimethylamine (1:1) structure
|
Common Name | 4-chloro-2-oxo-2H-benzothiazole-3-acetic acid, compound with dimethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 38561-76-1 | Molecular Weight | 288.75100 | |
| Density | N/A | Boiling Point | 468.4ºC at 760 mmHg | |
| Molecular Formula | C11H13ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.1ºC | |
| Name | benazolin-dimethylammonium |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 468.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.75100 |
| Flash Point | 237.1ºC |
| Exact Mass | 288.03400 |
| PSA | 99.57000 |
| LogP | 2.02750 |
| InChIKey | KKTYYONKWVCNJI-UHFFFAOYSA-N |
| SMILES | CNC.O=C(O)Cn1c(=O)sc2cccc(Cl)c21 |
| 4-chloro-2-oxo-3(2H)-benzothiazoleacetic acid compound with N-methylmethanamine (1:1) |
| dimethylammonium 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetate |
| 3(2h)-benzothiazoleacetic acid,4-chloro-2-oxo-,compd. with n-methylmethanamine(1:1) |
| 4-Chloro-2-oxo-2H-benzothiazole-3-acetic acid,compound with dimethylamine (1:1) |
| Benazolin-dimethylammonium [ISO] |
| Benazolin dimethylamine salt |
| EINECS 254-001-8 |
| 2-(4-chloro-2-oxo-1,3-benzothiazol-3-yl)acetic acid,N-methylmethanamine |
| Benazolin-dimethylammonium |
| 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid - dimethylamine (1:1) |
| (4-chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid—N-methylmethanamine |