3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one
Modify Date: 2025-09-17 17:32:04
3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one structure
|
Common Name | 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 38569-89-0 | Molecular Weight | 228.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20O |
|---|---|
| Molecular Weight | 228.33 |
| InChIKey | SJQMEMDAKCRMGG-UHFFFAOYSA-N |
| SMILES | CC1(C)CCc2cc3c(cc21)C(C)(C)CC3=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one? |
| A: Molecular formula of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one is C16H20O. |
| Q: What is the English name of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one? |
| A: The English name of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one is 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one. |
| Q: What is the InChIKey of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one? |
| A: InChIKey of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one is SJQMEMDAKCRMGG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one? |
| A: SMILES notation of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one is CC1(C)CCc2cc3c(cc21)C(C)(C)CC3=O. |
| Q: What is the molecular weight of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one? |
| A: Molecular weight of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one is 228.33. |
| Q: What is the CAS number of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one? |
| A: CAS number of 3,5,6,7-Tetrahydro-3,3,5,5-tetramethyl-s-indacen-1(2H)-one is 38569-89-0. |
| Q: What is the Chinese name of 38569-89-0? |
| A: Chinese name of 38569-89-0 is 38569-89-0. |