Ethyl 2,6-bis(trifluoromethyl)benzoate structure
|
Common Name | Ethyl 2,6-bis(trifluoromethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 38570-08-0 | Molecular Weight | 286.17000 | |
| Density | 1.357g/cm3 | Boiling Point | 245.1ºC at 760 mmHg | |
| Molecular Formula | C11H8F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 71.1ºC | |
| Name | Ethyl 2,6-bis(trifluoromethyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.357g/cm3 |
|---|---|
| Boiling Point | 245.1ºC at 760 mmHg |
| Molecular Formula | C11H8F6O2 |
| Molecular Weight | 286.17000 |
| Flash Point | 71.1ºC |
| Exact Mass | 286.04300 |
| PSA | 26.30000 |
| LogP | 3.90090 |
| Index of Refraction | 1.413 |
| InChIKey | RFRCILWTRIADIM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C(F)(F)F)cccc1C(F)(F)F |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,6-bis-trideuteriomethyl-pyridine |
| 2,6-Dimethyl-d6-pyridine |