H-Lys-Trp-Lys-OH acetate salt structure
|
Common Name | H-Lys-Trp-Lys-OH acetate salt | ||
|---|---|---|---|---|
| CAS Number | 38579-27-0 | Molecular Weight | 460.57000 | |
| Density | 1.251g/cm3 | Boiling Point | 931.6ºC at 760 mmHg | |
| Molecular Formula | C23H36N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 517.2ºC | |
Use of H-Lys-Trp-Lys-OH acetate saltH-Lys-Trp-Lys-OH is a small molecule peptide which displays antibacterial and antiviral activities extracted from patent CN 104072579 A, Compound AMP12. Sequence: H-Lys-Trp-Lys-OH. |
| Name | h-lys-trp-lys-oh |
|---|---|
| Synonym | More Synonyms |
| Description | H-Lys-Trp-Lys-OH is a small molecule peptide which displays antibacterial and antiviral activities extracted from patent CN 104072579 A, Compound AMP12. Sequence: H-Lys-Trp-Lys-OH. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 931.6ºC at 760 mmHg |
| Molecular Formula | C23H36N6O4 |
| Molecular Weight | 460.57000 |
| Flash Point | 517.2ºC |
| Exact Mass | 460.28000 |
| PSA | 189.35000 |
| LogP | 3.23260 |
| InChIKey | YUTZYVTZDVZBJJ-IHPCNDPISA-N |
| SMILES | NCCCCC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCCN)C(=O)O |
| Storage condition | 2-8℃ |
| lysine-tryptophane-lysine acetate |
| LYS-TRP-LYS ACETATE |