dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid
Modify Date: 2025-11-21 17:57:08
dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid structure
|
Common Name | dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid | ||
|---|---|---|---|---|
| CAS Number | 38596-35-9 | Molecular Weight | 444.56400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H36N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid |
|---|
| Molecular Formula | C25H36N2O5 |
|---|---|
| Molecular Weight | 444.56400 |
| Exact Mass | 444.26200 |
| PSA | 95.94000 |
| LogP | 4.96900 |
| InChIKey | YZBYZSRZSLSPSI-UHFFFAOYSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.O=C(O)C1CCC(=O)N1C(=O)OCc1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:2650-64-8