dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid
dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid structure
|
Common Name | dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid | ||
|---|---|---|---|---|
| CAS Number | 38596-35-9 | Molecular Weight | 444.56400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H36N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: The Chinese name is 二环己基胺盐酸盐 (dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid), CAS number is 38596-35-9, molecular formula is C25H36N2O5, and molecular weight is 444.56400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H36N2O5 |
|---|---|
| Molecular Weight | 444.56400 |
| Exact Mass | 444.26200 |
| PSA | 95.94000 |
| LogP | 4.96900 |
| InChIKey | YZBYZSRZSLSPSI-UHFFFAOYSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.O=C(O)C1CCC(=O)N1C(=O)OCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:2650-64-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid? |
| A: The English name of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid is dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid. |
| Q: What is the molecular formula of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid? |
| A: Molecular formula of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid is C25H36N2O5. |
| Q: What is the Chinese name of 38596-35-9? |
| A: Chinese name of 38596-35-9 is 38596-35-9. |
| Q: What is the SMILES notation of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid? |
| A: SMILES notation of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid is C1CCC(NC2CCCCC2)CC1.O=C(O)C1CCC(=O)N1C(=O)OCc1ccccc1. |
| Q: What is the polar surface area (PSA) of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid? |
| A: Polar surface area (PSA) of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid is 95.94000. |
| Q: What are the downstream products of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid? |
| A: Related downstream products(CAS) of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid: 2650-64-8. |
| Q: What is the molecular weight of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid? |
| A: Molecular weight of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid is 444.56400. |
| Q: What is the CAS number of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid? |
| A: CAS number of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid is 38596-35-9. |
| Q: What is the LogP of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid? |
| A: LogP of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid is 4.96900. |
| Q: What is the InChIKey of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid? |
| A: InChIKey of dicyclohexylamine salt of N-benzyloxycarbonyl-(L)-pyroglutamic acid is YZBYZSRZSLSPSI-UHFFFAOYSA-N. |